Difference between revisions of "CPD-19160"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-DIHYDROXY-PHENYLALANINE == * common-name: ** l-dopa * molecular-weight: ** 197.19 * inchi-key: ** wtdrdqbearuvnc-lurjtmiesa-n * smiles:...")
 
(Created page with "Category:metabolite == Metabolite CPD-19160 == * common-name: ** 3-oxo-(11z)-octadecenoyl-coa * molecular-weight: ** 1041.936 * inchi-key: ** ourowzutgfhrje-saiinbspsa-j *...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-DIHYDROXY-PHENYLALANINE ==
+
== Metabolite CPD-19160 ==
 
* common-name:
 
* common-name:
** l-dopa
+
** 3-oxo-(11z)-octadecenoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 197.19
+
** 1041.936
 
* inchi-key:
 
* inchi-key:
** wtdrdqbearuvnc-lurjtmiesa-n
+
** ourowzutgfhrje-saiinbspsa-j
 
* smiles:
 
* smiles:
** c(c(cc1(c=cc(o)=c(o)c=1))[n+])(=o)[o-]
+
** ccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13061]]
+
* [[RXN-17787]]
* [[RXN66-221]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11369]]
+
* [[RXN-17786]]
* [[RXN-5861]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-dopa}}
+
{{#set: common-name=3-oxo-(11z)-octadecenoyl-coa}}
{{#set: molecular-weight=197.19}}
+
{{#set: molecular-weight=1041.936}}
{{#set: inchi-key=inchikey=wtdrdqbearuvnc-lurjtmiesa-n}}
+
{{#set: inchi-key=inchikey=ourowzutgfhrje-saiinbspsa-j}}

Latest revision as of 19:37, 17 March 2021

Metabolite CPD-19160

  • common-name:
    • 3-oxo-(11z)-octadecenoyl-coa
  • molecular-weight:
    • 1041.936
  • inchi-key:
    • ourowzutgfhrje-saiinbspsa-j
  • smiles:
    • ccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality