Difference between revisions of "CPD-707"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PANTETHEINE-P == * common-name: ** 4'-phosphopantetheine * molecular-weight: ** 356.33 * inchi-key: ** jdmuprlruumctl-vifpvbqesa-l * smil...")
(Created page with "Category:metabolite == Metabolite CPD-707 == * common-name: ** campesterol * molecular-weight: ** 400.687 * inchi-key: ** sgnbvlswzmbqth-podylutmsa-n * smiles: ** cc(c)c(c...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PANTETHEINE-P ==
+
== Metabolite CPD-707 ==
 
* common-name:
 
* common-name:
** 4'-phosphopantetheine
+
** campesterol
 
* molecular-weight:
 
* molecular-weight:
** 356.33
+
** 400.687
 
* inchi-key:
 
* inchi-key:
** jdmuprlruumctl-vifpvbqesa-l
+
** sgnbvlswzmbqth-podylutmsa-n
 
* smiles:
 
* smiles:
** cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-]
+
** cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PANTEPADENYLYLTRAN-RXN]]
+
* [[RXN-4225]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.4.14-RXN]]
 
* [[P-PANTOCYSDECARB-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4'-phosphopantetheine}}
+
{{#set: common-name=campesterol}}
{{#set: molecular-weight=356.33}}
+
{{#set: molecular-weight=400.687}}
{{#set: inchi-key=inchikey=jdmuprlruumctl-vifpvbqesa-l}}
+
{{#set: inchi-key=inchikey=sgnbvlswzmbqth-podylutmsa-n}}

Latest revision as of 19:37, 17 March 2021

Metabolite CPD-707

  • common-name:
    • campesterol
  • molecular-weight:
    • 400.687
  • inchi-key:
    • sgnbvlswzmbqth-podylutmsa-n
  • smiles:
    • cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality