Difference between revisions of "CPD-707"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite THIAMINE-PYROPHOSPHATE == * common-name: ** thiamine diphosphate * molecular-weight: ** 422.288 * inchi-key: ** ayekofbpnlcajy-uhfffaoysa...")
(Created page with "Category:metabolite == Metabolite CPD-707 == * common-name: ** campesterol * molecular-weight: ** 400.687 * inchi-key: ** sgnbvlswzmbqth-podylutmsa-n * smiles: ** cc(c)c(c...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite THIAMINE-PYROPHOSPHATE ==
+
== Metabolite CPD-707 ==
 
* common-name:
 
* common-name:
** thiamine diphosphate
+
** campesterol
 
* molecular-weight:
 
* molecular-weight:
** 422.288
+
** 400.687
 
* inchi-key:
 
* inchi-key:
** ayekofbpnlcajy-uhfffaoysa-l
+
** sgnbvlswzmbqth-podylutmsa-n
 
* smiles:
 
* smiles:
** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
+
** cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12583]]
+
* [[RXN-4225]]
* [[RXN0-3542]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12508]]
 
* [[RXN0-3542]]
 
* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=thiamine diphosphate}}
+
{{#set: common-name=campesterol}}
{{#set: molecular-weight=422.288}}
+
{{#set: molecular-weight=400.687}}
{{#set: inchi-key=inchikey=ayekofbpnlcajy-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=sgnbvlswzmbqth-podylutmsa-n}}

Latest revision as of 19:37, 17 March 2021

Metabolite CPD-707

  • common-name:
    • campesterol
  • molecular-weight:
    • 400.687
  • inchi-key:
    • sgnbvlswzmbqth-podylutmsa-n
  • smiles:
    • cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality