Difference between revisions of "A-pyruvate-dehydrogenase-E2-protein-Nsup"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXY-CTP == * common-name: ** 5-hydroxy-ctp * molecular-weight: ** 495.126 * inchi-key: ** dmfodundoduqkk-uakxsshosa-j * smiles: **...")
(Created page with "Category:metabolite == Metabolite a-pyruvate-dehydrogenase-E2-protein-Nsup == * common-name: ** a [pyruvate dehydrogenase e2 protein] n6-octanoyl-l-lysine == Reaction(s) k...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-HYDROXY-CTP ==
+
== Metabolite a-pyruvate-dehydrogenase-E2-protein-Nsup ==
 
* common-name:
 
* common-name:
** 5-hydroxy-ctp
+
** a [pyruvate dehydrogenase e2 protein] n6-octanoyl-l-lysine
* molecular-weight:
 
** 495.126
 
* inchi-key:
 
** dmfodundoduqkk-uakxsshosa-j
 
* smiles:
 
** c(c2(c(c(o)c(n1(c(n=c(c(o)=c1)n)=o))o2)o))op(op(op([o-])([o-])=o)([o-])=o)([o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14957]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-7080]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-hydroxy-ctp}}
+
{{#set: common-name=a [pyruvate dehydrogenase e2 protein] n6-octanoyl-l-lysine}}
{{#set: molecular-weight=495.126}}
 
{{#set: inchi-key=inchikey=dmfodundoduqkk-uakxsshosa-j}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite a-pyruvate-dehydrogenase-E2-protein-Nsup

  • common-name:
    • a [pyruvate dehydrogenase e2 protein] n6-octanoyl-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [pyruvate dehydrogenase e2 protein] n6-octanoyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.