Difference between revisions of "2E-7Z-hexadeca-2-7-dienoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11409 == * common-name: ** tetraiodothyroacetate ether glucuronide * molecular-weight: ** 921.943 * inchi-key: ** gyorpzqlvmnogy-rupw...")
(Created page with "Category:metabolite == Metabolite 2E-7Z-hexadeca-2-7-dienoyl-ACPs == * common-name: ** a (2e,7z)-hexadeca-2,7-dienoyl-[acp] == Reaction(s) known to consume the compound ==...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-11409 ==
+
== Metabolite 2E-7Z-hexadeca-2-7-dienoyl-ACPs ==
 
* common-name:
 
* common-name:
−
** tetraiodothyroacetate ether glucuronide
+
** a (2e,7z)-hexadeca-2,7-dienoyl-[acp]
−
* molecular-weight:
 
−
** 921.943
 
−
* inchi-key:
 
−
** gyorpzqlvmnogy-rupwjetcsa-l
 
−
* smiles:
 
−
** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c(i)=c3))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16624]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-10616]]
+
* [[RXN-16623]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=tetraiodothyroacetate ether glucuronide}}
+
{{#set: common-name=a (2e,7z)-hexadeca-2,7-dienoyl-[acp]}}
−
{{#set: molecular-weight=921.943}}
 
−
{{#set: inchi-key=inchikey=gyorpzqlvmnogy-rupwjetcsa-l}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite 2E-7Z-hexadeca-2-7-dienoyl-ACPs

  • common-name:
    • a (2e,7z)-hexadeca-2,7-dienoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (2e,7z)-hexadeca-2,7-dienoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=2E-7Z-hexadeca-2-7-dienoyl-ACPs&oldid=48514"