Difference between revisions of "CPD-24185"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDROKAEMPFEROL-CMPD == * common-name: ** (+)-dihydrokaempferol * molecular-weight: ** 288.256 * inchi-key: ** padqinqhpqkxnl-lsdhhaius...")
(Created page with "Category:metabolite == Metabolite CPD-24185 == == Reaction(s) known to consume the compound == * RXN-22198 == Reaction(s) known to produce the compound == * RXN-2220...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DIHYDROKAEMPFEROL-CMPD ==
+
== Metabolite CPD-24185 ==
* common-name:
 
** (+)-dihydrokaempferol
 
* molecular-weight:
 
** 288.256
 
* inchi-key:
 
** padqinqhpqkxnl-lsdhhaiusa-n
 
* smiles:
 
** c1(=c(c=cc(=c1)o)c2(oc3(c(c(c2o)=o)=c(o)c=c(o)c=3)))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]]
+
* [[RXN-22198]]
* [[RXN1F-93]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NARINGENIN-3-DIOXYGENASE-RXN]]
+
* [[RXN-22206]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(+)-dihydrokaempferol}}
 
{{#set: molecular-weight=288.256}}
 
{{#set: inchi-key=inchikey=padqinqhpqkxnl-lsdhhaiusa-n}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite CPD-24185

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality