Difference between revisions of "Sugar"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-2 == * common-name: ** (-)-methyl jasmonate * molecular-weight: ** 224.299 * inchi-key: ** gewdntwnsazudx-wqmvxfaesa-n * smiles: **...")
(Created page with "Category:metabolite == Metabolite Sugar == * common-name: ** a sugar == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == * SU...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1F-2 ==
+
== Metabolite Sugar ==
 
* common-name:
 
* common-name:
** (-)-methyl jasmonate
+
** a sugar
* molecular-weight:
 
** 224.299
 
* inchi-key:
 
** gewdntwnsazudx-wqmvxfaesa-n
 
* smiles:
 
** ccc=ccc1(c(=o)ccc1cc(oc)=o)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10767]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[SUGAR-PHOSPHATASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(-)-methyl jasmonate}}
+
{{#set: common-name=a sugar}}
{{#set: molecular-weight=224.299}}
 
{{#set: inchi-key=inchikey=gewdntwnsazudx-wqmvxfaesa-n}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite Sugar

  • common-name:
    • a sugar

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality