Difference between revisions of "ACETYLSERINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GLYCEROL-3P == * common-name: ** sn-glycerol 3-phosphate * molecular-weight: ** 170.058 * inchi-key: ** awucvroldviajx-gsvougtgsa-l * smi...")
(Created page with "Category:metabolite == Metabolite ACETYLSERINE == * common-name: ** o-acetyl-l-serine * molecular-weight: ** 147.13 * inchi-key: ** vzxpdpzarilfqx-bypyzucnsa-n * smiles: *...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GLYCEROL-3P ==
+
== Metabolite ACETYLSERINE ==
 
* common-name:
 
* common-name:
** sn-glycerol 3-phosphate
+
** o-acetyl-l-serine
 
* molecular-weight:
 
* molecular-weight:
** 170.058
+
** 147.13
 
* inchi-key:
 
* inchi-key:
** awucvroldviajx-gsvougtgsa-l
+
** vzxpdpzarilfqx-bypyzucnsa-n
 
* smiles:
 
* smiles:
** c(op([o-])(=o)[o-])c(o)co
+
** cc(occ([n+])c(=o)[o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLYCEROL-KIN-RXN]]
+
* [[ACSERLY-RXN]]
* [[PHOSPHAGLYPSYN-RXN]]
+
* [[RXN-12726]]
* [[RXN-1381]]
+
* [[SULFOCYS-RXN]]
* [[RXN-15045]]
 
* [[RXN0-5260]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.8-RXN]]
+
* [[ACSERLY-RXN]]
* [[GLYC3PDEHYDROGBIOSYN-RXN]]
+
* [[SERINE-O-ACETTRAN-RXN]]
* [[GLYCEROL-KIN-RXN]]
+
* [[SULFOCYS-RXN]]
* [[GLYCPDIESTER-RXN]]
 
* [[RXN-14073]]
 
* [[RXN-14136]]
 
* [[RXN-14160]]
 
* [[RXN0-5257]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=sn-glycerol 3-phosphate}}
+
{{#set: common-name=o-acetyl-l-serine}}
{{#set: molecular-weight=170.058}}
+
{{#set: molecular-weight=147.13}}
{{#set: inchi-key=inchikey=awucvroldviajx-gsvougtgsa-l}}
+
{{#set: inchi-key=inchikey=vzxpdpzarilfqx-bypyzucnsa-n}}

Latest revision as of 19:34, 17 March 2021

Metabolite ACETYLSERINE

  • common-name:
    • o-acetyl-l-serine
  • molecular-weight:
    • 147.13
  • inchi-key:
    • vzxpdpzarilfqx-bypyzucnsa-n
  • smiles:
    • cc(occ([n+])c(=o)[o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality