Difference between revisions of "3-OXOPIMELOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-166 == * common-name: ** a dolichyl β-d-glucosyl phosphate == Reaction(s) known to consume the compound == * RXN-16593 * R...") |
(Created page with "Category:metabolite == Metabolite 3-OXOPIMELOYL-COA == * common-name: ** 3-oxopimeloyl-coa * molecular-weight: ** 918.632 * inchi-key: ** kjxfofktzdjlmq-uyrkptjqsa-i * smi...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 3-OXOPIMELOYL-COA == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-oxopimeloyl-coa |
+ | * molecular-weight: | ||
+ | ** 918.632 | ||
+ | * inchi-key: | ||
+ | ** kjxfofktzdjlmq-uyrkptjqsa-i | ||
+ | * smiles: | ||
+ | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(cccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-8032]] |
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN-8032]] | |
− | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-oxopimeloyl-coa}} |
+ | {{#set: molecular-weight=918.632}} | ||
+ | {{#set: inchi-key=inchikey=kjxfofktzdjlmq-uyrkptjqsa-i}} |
Latest revision as of 19:35, 17 March 2021
Contents
Metabolite 3-OXOPIMELOYL-COA
- common-name:
- 3-oxopimeloyl-coa
- molecular-weight:
- 918.632
- inchi-key:
- kjxfofktzdjlmq-uyrkptjqsa-i
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(cccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]