Difference between revisions of "ASN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ASN == * common-name: ** l-asparagine * molecular-weight: ** 132.119 * inchi-key: ** dcxyfedjocdnaf-reohclbhsa-n * smiles: ** c(cc(c(=o)[...") |
(Created page with "Category:metabolite == Metabolite ASN == * common-name: ** l-asparagine * molecular-weight: ** 132.119 * inchi-key: ** dcxyfedjocdnaf-reohclbhsa-n * smiles: ** c(cc(c(=o)[...") |
| (2 intermediate revisions by the same user not shown) | |
(No difference)
| |
Latest revision as of 19:37, 17 March 2021
Contents
Metabolite ASN
- common-name:
- l-asparagine
- molecular-weight:
- 132.119
- inchi-key:
- dcxyfedjocdnaf-reohclbhsa-n
- smiles:
- c(cc(c(=o)[o-])[n+])(n)=o
