Difference between revisions of "2-KETO-6-AMINO-CAPROATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDROXY-ACETONE-PHOSPHATE == * common-name: ** glycerone phosphate * molecular-weight: ** 168.043 * inchi-key: ** gngacratggdkbx-uhfffa...")
(Created page with "Category:metabolite == Metabolite 2-KETO-6-AMINO-CAPROATE == * common-name: ** 6-amino-2-oxohexanoate * molecular-weight: ** 145.158 * inchi-key: ** gwenqmvpljamae-uhfffao...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DIHYDROXY-ACETONE-PHOSPHATE ==
+
== Metabolite 2-KETO-6-AMINO-CAPROATE ==
 
* common-name:
 
* common-name:
** glycerone phosphate
+
** 6-amino-2-oxohexanoate
 
* molecular-weight:
 
* molecular-weight:
** 168.043
+
** 145.158
 
* inchi-key:
 
* inchi-key:
** gngacratggdkbx-uhfffaoysa-l
+
** gwenqmvpljamae-uhfffaoysa-n
 
* smiles:
 
* smiles:
** c(c(=o)co)op([o-])([o-])=o
+
** c(cc(=o)c(=o)[o-])cc[n+]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.8-RXN]]
+
* [[RXN-8172]]
* [[F16ALDOLASE-RXN]]
+
* [[RXN-8243]]
* [[GLYC3PDEHYDROGBIOSYN-RXN]]
 
* [[QUINOLINATE-SYNTHA-RXN]]
 
* [[RXN-15044]]
 
* [[RXN0-5257]]
 
* [[SEDOBISALDOL-RXN]]
 
* [[TRIOSEPISOMERIZATION-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[F16ALDOLASE-RXN]]
+
* [[L-LYSINE-OXIDASE-RXN]]
* [[GLYCERONE-KINASE-RXN]]
 
* [[RXN-8631]]
 
* [[RXN0-5260]]
 
* [[SEDOBISALDOL-RXN]]
 
* [[TRIOSEPISOMERIZATION-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=glycerone phosphate}}
+
{{#set: common-name=6-amino-2-oxohexanoate}}
{{#set: molecular-weight=168.043}}
+
{{#set: molecular-weight=145.158}}
{{#set: inchi-key=inchikey=gngacratggdkbx-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=gwenqmvpljamae-uhfffaoysa-n}}

Latest revision as of 19:33, 17 March 2021

Metabolite 2-KETO-6-AMINO-CAPROATE

  • common-name:
    • 6-amino-2-oxohexanoate
  • molecular-weight:
    • 145.158
  • inchi-key:
    • gwenqmvpljamae-uhfffaoysa-n
  • smiles:
    • c(cc(=o)c(=o)[o-])cc[n+]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality