Difference between revisions of "Aliphatic-Alpha-Omega-Diamines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12173 == * common-name: ** (s)-3-hydroxy-isobutanoyl-coa * molecular-weight: ** 849.593 * inchi-key: ** wweogfzefhpuam-uqcjfraesa-j *...")
(Created page with "Category:metabolite == Metabolite Aliphatic-Alpha-Omega-Diamines == * common-name: ** an aliphatic α,ω-diamine == Reaction(s) known to consume the compound ==...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12173 ==
+
== Metabolite Aliphatic-Alpha-Omega-Diamines ==
 
* common-name:
 
* common-name:
** (s)-3-hydroxy-isobutanoyl-coa
+
** an aliphatic α,ω-diamine
* molecular-weight:
 
** 849.593
 
* inchi-key:
 
** wweogfzefhpuam-uqcjfraesa-j
 
* smiles:
 
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])co
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3-HYDROXYISOBUTYRYL-COA-HYDROLASE-RXN]]
+
* [[DIAMTRANSAM-RXN]]
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
+
* [[DIAMTRANSAM-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-3-hydroxy-isobutanoyl-coa}}
+
{{#set: common-name=an aliphatic α,ω-diamine}}
{{#set: molecular-weight=849.593}}
 
{{#set: inchi-key=inchikey=wweogfzefhpuam-uqcjfraesa-j}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite Aliphatic-Alpha-Omega-Diamines

  • common-name:
    • an aliphatic α,ω-diamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality