Difference between revisions of "ACP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13575 == * common-name: ** 2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate * molecular-weight: ** 264.169 * inchi-...")
(Created page with "Category:metabolite == Metabolite ACP == * common-name: ** a soluble [acyl-carrier protein] == Reaction(s) known to consume the compound == * 3.1.4.14-RXN * ACP-S-AC...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13575 ==
+
== Metabolite ACP ==
 
* common-name:
 
* common-name:
** 2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate
+
** a soluble [acyl-carrier protein]
* molecular-weight:
 
** 264.169
 
* inchi-key:
 
** pqmcqnovnfnpfj-hyimlasbsa-k
 
* smiles:
 
** cc1(c(=ccop([o-])(=o)[o-])sc(c(=o)[o-])n=1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12611]]
+
* [[3.1.4.14-RXN]]
 +
* [[ACP-S-ACETYLTRANSFER-RXN]]
 +
* [[ExchangeSeed-ACP]]
 +
* [[MALONYL-COA-ACP-TRANSACYL-RXN]]
 +
* [[RXN-17155]]
 +
* [[RXN-8349_PLANTCYC]]
 +
* [[TransportSeed-ACP]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[2.3.1.179-RXN]]
 +
* [[2.3.1.41-RXN]]
 +
* [[3-OXOACYL-ACP-SYNTH-BASE-RXN]]
 +
* [[3-OXOACYL-ACP-SYNTH-RXN]]
 +
* [[ACP-S-ACETYLTRANSFER-RXN]]
 +
* [[ExchangeSeed-ACP]]
 +
* [[PALMITOTRANS-RXN]]
 +
* [[RXN-10654]]
 +
* [[RXN-10658]]
 +
* [[RXN-10727]]
 +
* [[RXN-11474]]
 +
* [[RXN-11479]]
 +
* [[RXN-14972]]
 +
* [[RXN-16615]]
 +
* [[RXN-16621]]
 +
* [[RXN-16625]]
 +
* [[RXN-16629]]
 +
* [[RXN-8349_PLANTCYC]]
 +
* [[RXN-9516]]
 +
* [[RXN-9523]]
 +
* [[RXN-9527]]
 +
* [[RXN-9531]]
 +
* [[RXN-9535]]
 +
* [[RXN-9539]]
 +
* [[RXN-9548]]
 +
* [[RXN-9549]]
 +
* [[RXN-9550]]
 +
* [[RXN-9555]]
 +
* [[RXN0-2141]]
 +
* [[RXN0-947]]
 +
* [[RXN1G-3993]]
 +
* [[RXN1G-4140]]
 +
* [[RXN3O-1803]]
 +
* [[RXN3O-5304]]
 +
* [[RXN3O-9780]]
 +
* [[TransportSeed-ACP]]
 +
* [[UDPHYDROXYMYRGLUCOSAMNACETYLTRANS-RXN]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate}}
+
{{#set: common-name=a soluble [acyl-carrier protein]}}
{{#set: molecular-weight=264.169}}
 
{{#set: inchi-key=inchikey=pqmcqnovnfnpfj-hyimlasbsa-k}}
 

Latest revision as of 19:34, 17 March 2021