Difference between revisions of "7-AMINOMETHYL-7-DEAZAGUANINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 1-3-beta-D-Glucans == * common-name: ** a 1,3-β-d-glucan == Reaction(s) known to consume the compound == * 13-BETA-GLUCAN-SYNTHASE...")
(Created page with "Category:metabolite == Metabolite 7-AMINOMETHYL-7-DEAZAGUANINE == * common-name: ** preq1 * molecular-weight: ** 180.189 * inchi-key: ** meymblgokydglz-uhfffaoysa-o * smil...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 1-3-beta-D-Glucans ==
+
== Metabolite 7-AMINOMETHYL-7-DEAZAGUANINE ==
 
* common-name:
 
* common-name:
** a 1,3-β-d-glucan
+
** preq1
 +
* molecular-weight:
 +
** 180.189
 +
* inchi-key:
 +
** meymblgokydglz-uhfffaoysa-o
 +
* smiles:
 +
** c([n+])c2(c1(c(=o)nc(n)=nc=1nc=2))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
+
* [[RXN0-1321]]
* [[3.2.1.39-RXN]]
 
* [[3.2.1.58-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
 
* [[3.2.1.39-RXN]]
 
* [[3.2.1.58-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 1,3-β-d-glucan}}
+
{{#set: common-name=preq1}}
 +
{{#set: molecular-weight=180.189}}
 +
{{#set: inchi-key=inchikey=meymblgokydglz-uhfffaoysa-o}}

Latest revision as of 19:35, 17 March 2021

Metabolite 7-AMINOMETHYL-7-DEAZAGUANINE

  • common-name:
    • preq1
  • molecular-weight:
    • 180.189
  • inchi-key:
    • meymblgokydglz-uhfffaoysa-o
  • smiles:
    • c([n+])c2(c1(c(=o)nc(n)=nc=1nc=2))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality