Difference between revisions of "TRNA-Sec"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 1-L-MYO-INOSITOL-1-P == * common-name: ** 1d-myo-inositol 3-monophosphate * molecular-weight: ** 258.121 * inchi-key: ** inapmgsxuvuwaf-p...")
(Created page with "Category:metabolite == Metabolite tRNA-Sec == * common-name: ** a trnasec == Reaction(s) known to consume the compound == * RXN0-2161 == Reaction(s) known to produce t...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 1-L-MYO-INOSITOL-1-P ==
+
== Metabolite tRNA-Sec ==
 
* common-name:
 
* common-name:
** 1d-myo-inositol 3-monophosphate
+
** a trnasec
* molecular-weight:
 
** 258.121
 
* inchi-key:
 
** inapmgsxuvuwaf-ptqmnwpwsa-l
 
* smiles:
 
** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]]
+
* [[RXN0-2161]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]]
 
* [[RXN66-579]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1d-myo-inositol 3-monophosphate}}
+
{{#set: common-name=a trnasec}}
{{#set: molecular-weight=258.121}}
 
{{#set: inchi-key=inchikey=inapmgsxuvuwaf-ptqmnwpwsa-l}}
 

Latest revision as of 19:35, 17 March 2021

Metabolite tRNA-Sec

  • common-name:
    • a trnasec

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality