Difference between revisions of "3-SULFINOALANINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Apo-FeS-cluster-proteins == * common-name: ** an apo-iron-sulfur protein == Reaction(s) known to consume the compound == * RXN-14390...") |
(Created page with "Category:metabolite == Metabolite 3-SULFINOALANINE == * common-name: ** 3-sulfino-l-alanine * molecular-weight: ** 152.145 * inchi-key: ** advptqaunprnpo-reohclbhsa-m * sm...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 3-SULFINOALANINE == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-sulfino-l-alanine |
+ | * molecular-weight: | ||
+ | ** 152.145 | ||
+ | * inchi-key: | ||
+ | ** advptqaunprnpo-reohclbhsa-m | ||
+ | * smiles: | ||
+ | ** c(c([n+])c(=o)[o-])s([o-])=o | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]] | ||
+ | * [[CYSTEINE-DIOXYGENASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-sulfino-l-alanine}} |
+ | {{#set: molecular-weight=152.145}} | ||
+ | {{#set: inchi-key=inchikey=advptqaunprnpo-reohclbhsa-m}} |
Latest revision as of 19:35, 17 March 2021
Contents
Metabolite 3-SULFINOALANINE
- common-name:
- 3-sulfino-l-alanine
- molecular-weight:
- 152.145
- inchi-key:
- advptqaunprnpo-reohclbhsa-m
- smiles:
- c(c([n+])c(=o)[o-])s([o-])=o