Difference between revisions of "ADENOSINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite OXALACETIC_ACID == * common-name: ** oxaloacetate * molecular-weight: ** 130.057 * inchi-key: ** khpxuqmniqbqev-uhfffaoysa-l * smiles: **...") |
(Created page with "Category:metabolite == Metabolite ADENOSINE == * common-name: ** adenosine * molecular-weight: ** 267.244 * inchi-key: ** oirdtqyftabqoq-kqynxxcusa-n * smiles: ** c(o)c1(o...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ADENOSINE == |
* common-name: | * common-name: | ||
− | ** | + | ** adenosine |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 267.244 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** oirdtqyftabqoq-kqynxxcusa-n |
* smiles: | * smiles: | ||
− | ** c(c( | + | ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ADENODEAMIN-RXN]] |
− | * [[ | + | * [[ADENOSINE-KINASE-RXN]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ADENOSYLHOMOCYSTEINASE-RXN]] |
− | * [[ | + | * [[AMP-DEPHOSPHORYLATION-RXN]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=adenosine}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=267.244}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oirdtqyftabqoq-kqynxxcusa-n}} |
Latest revision as of 19:33, 17 March 2021
Contents
Metabolite ADENOSINE
- common-name:
- adenosine
- molecular-weight:
- 267.244
- inchi-key:
- oirdtqyftabqoq-kqynxxcusa-n
- smiles:
- c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))