Difference between revisions of "Amino-Acids-20"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite NICOTINAMIDE_NUCLEOTIDE == * common-name: ** β-nicotinamide d-ribonucleotide * molecular-weight: ** 333.214 * inchi-key: ** dayljwod...")
 
(Created page with "Category:metabolite == Metabolite Amino-Acids-20 == * common-name: ** a proteinogenic amino acid == Reaction(s) known to consume the compound == * L-AMINO-ACID-OXIDASE-R...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite NICOTINAMIDE_NUCLEOTIDE ==
+
== Metabolite Amino-Acids-20 ==
 
* common-name:
 
* common-name:
** β-nicotinamide d-ribonucleotide
+
** a proteinogenic amino acid
* molecular-weight:
 
** 333.214
 
* inchi-key:
 
** dayljwodmcoqew-turqnecasa-m
 
* smiles:
 
** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.7.1-RXN]]
+
* [[L-AMINO-ACID-OXIDASE-RXN]]
* [[RXN-5841]]
+
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 +
* [[RXN-6601]]
 +
* [[RXN66-336]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DNA-LIGASE-NAD+-RXN]]
+
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
* [[NADPYROPHOSPHAT-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-nicotinamide d-ribonucleotide}}
+
{{#set: common-name=a proteinogenic amino acid}}
{{#set: molecular-weight=333.214}}
 
{{#set: inchi-key=inchikey=dayljwodmcoqew-turqnecasa-m}}
 

Latest revision as of 19:32, 17 March 2021

Metabolite Amino-Acids-20

  • common-name:
    • a proteinogenic amino acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality