Difference between revisions of "2-KETO-6-AMINO-CAPROATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15364 == * common-name: ** ricinoleoyl-coa * molecular-weight: ** 1043.952 * inchi-key: ** bhvzcckrrpyxcv-mgnvxpimsa-j * smiles: ** c...")
 
(Created page with "Category:metabolite == Metabolite 2-KETO-6-AMINO-CAPROATE == * common-name: ** 6-amino-2-oxohexanoate * molecular-weight: ** 145.158 * inchi-key: ** gwenqmvpljamae-uhfffao...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-15364 ==
+
== Metabolite 2-KETO-6-AMINO-CAPROATE ==
 
* common-name:
 
* common-name:
−
** ricinoleoyl-coa
+
** 6-amino-2-oxohexanoate
 
* molecular-weight:
 
* molecular-weight:
−
** 1043.952
+
** 145.158
 
* inchi-key:
 
* inchi-key:
−
** bhvzcckrrpyxcv-mgnvxpimsa-j
+
** gwenqmvpljamae-uhfffaoysa-n
 
* smiles:
 
* smiles:
−
** ccccccc(o)cc=ccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** c(cc(=o)c(=o)[o-])cc[n+]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-16151]]
+
* [[RXN-8172]]
 +
* [[RXN-8243]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-16151]]
+
* [[L-LYSINE-OXIDASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=ricinoleoyl-coa}}
+
{{#set: common-name=6-amino-2-oxohexanoate}}
−
{{#set: molecular-weight=1043.952}}
+
{{#set: molecular-weight=145.158}}
−
{{#set: inchi-key=inchikey=bhvzcckrrpyxcv-mgnvxpimsa-j}}
+
{{#set: inchi-key=inchikey=gwenqmvpljamae-uhfffaoysa-n}}

Latest revision as of 19:33, 17 March 2021

Metabolite 2-KETO-6-AMINO-CAPROATE

  • common-name:
    • 6-amino-2-oxohexanoate
  • molecular-weight:
    • 145.158
  • inchi-key:
    • gwenqmvpljamae-uhfffaoysa-n
  • smiles:
    • c(cc(=o)c(=o)[o-])cc[n+]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=2-KETO-6-AMINO-CAPROATE&oldid=48669"