Difference between revisions of "VAL-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXY-FERULIC-ACID == * common-name: ** 5-hydroxyferulate * molecular-weight: ** 209.178 * inchi-key: ** yfxwtvldsksylw-nscuhmnnsa-m...")
 
(Created page with "Category:metabolite == Metabolite VAL-tRNAs == * common-name: ** a trnaval == Reaction(s) known to consume the compound == * VALINE--TRNA-LIGASE-RXN == Reaction(s) kno...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-HYDROXY-FERULIC-ACID ==
+
== Metabolite VAL-tRNAs ==
 
* common-name:
 
* common-name:
** 5-hydroxyferulate
+
** a trnaval
* molecular-weight:
 
** 209.178
 
* inchi-key:
 
** yfxwtvldsksylw-nscuhmnnsa-m
 
* smiles:
 
** coc1(c=c(c=cc([o-])=o)c=c(o)c(o)=1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[VALINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1121]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-hydroxyferulate}}
+
{{#set: common-name=a trnaval}}
{{#set: molecular-weight=209.178}}
 
{{#set: inchi-key=inchikey=yfxwtvldsksylw-nscuhmnnsa-m}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite VAL-tRNAs

  • common-name:
    • a trnaval

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality