Difference between revisions of "2-DEHYDROPANTOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SHIKIMATE == * common-name: ** shikimate * molecular-weight: ** 173.145 * inchi-key: ** jxohggnkmltubp-hsuxutppsa-m * smiles: ** c1(=c(cc...")
 
(Created page with "Category:metabolite == Metabolite 2-DEHYDROPANTOATE == * common-name: ** 2-dehydropantoate * molecular-weight: ** 145.135 * inchi-key: ** pkvvtuwhanfmqc-uhfffaoysa-m * smi...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SHIKIMATE ==
+
== Metabolite 2-DEHYDROPANTOATE ==
 
* common-name:
 
* common-name:
** shikimate
+
** 2-dehydropantoate
 
* molecular-weight:
 
* molecular-weight:
** 173.145
+
** 145.135
 
* inchi-key:
 
* inchi-key:
** jxohggnkmltubp-hsuxutppsa-m
+
** pkvvtuwhanfmqc-uhfffaoysa-m
 
* smiles:
 
* smiles:
** c1(=c(cc(c(o)c(o)1)o)c(=o)[o-])
+
** cc(c(=o)c([o-])=o)(co)c
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7968]]
+
* [[3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN]]
* [[SHIKIMATE-KINASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[SHIKIMATE-5-DEHYDROGENASE-RXN]]
+
* [[3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN]]
* [[SHIKIMATE-KINASE-RXN]]
+
* [[RXN-15635]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=shikimate}}
+
{{#set: common-name=2-dehydropantoate}}
{{#set: molecular-weight=173.145}}
+
{{#set: molecular-weight=145.135}}
{{#set: inchi-key=inchikey=jxohggnkmltubp-hsuxutppsa-m}}
+
{{#set: inchi-key=inchikey=pkvvtuwhanfmqc-uhfffaoysa-m}}

Latest revision as of 19:35, 17 March 2021

Metabolite 2-DEHYDROPANTOATE

  • common-name:
    • 2-dehydropantoate
  • molecular-weight:
    • 145.135
  • inchi-key:
    • pkvvtuwhanfmqc-uhfffaoysa-m
  • smiles:
    • cc(c(=o)c([o-])=o)(co)c

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality