Difference between revisions of "3-SULFINOALANINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DMPBQ == * common-name: ** 2,3-dimethyl-6-phytyl-1,4-benzoquinol * molecular-weight: ** 416.686 * inchi-key: ** sufzkubnovdjrr-wgeodtkdsa...") |
(Created page with "Category:metabolite == Metabolite 3-SULFINOALANINE == * common-name: ** 3-sulfino-l-alanine * molecular-weight: ** 152.145 * inchi-key: ** advptqaunprnpo-reohclbhsa-m * sm...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-SULFINOALANINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-sulfino-l-alanine |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 152.145 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** advptqaunprnpo-reohclbhsa-m |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c([n+])c(=o)[o-])s([o-])=o |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]] |
| + | * [[CYSTEINE-DIOXYGENASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-sulfino-l-alanine}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=152.145}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=advptqaunprnpo-reohclbhsa-m}} |
Latest revision as of 19:35, 17 March 2021
Contents
Metabolite 3-SULFINOALANINE
- common-name:
- 3-sulfino-l-alanine
- molecular-weight:
- 152.145
- inchi-key:
- advptqaunprnpo-reohclbhsa-m
- smiles:
- c(c([n+])c(=o)[o-])s([o-])=o
