Difference between revisions of "3-oxo-D5-steroids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite COPROPORPHYRINOGEN_III == * common-name: ** coproporphyrinogen iii * molecular-weight: ** 656.734 * inchi-key: ** niuvhxtxuxofeb-uhfffaoy...")
 
(Created page with "Category:metabolite == Metabolite 3-oxo-D5-steroids == * common-name: ** a 3-oxo-δ5-steroid == Reaction(s) known to consume the compound == * 1.1.1.145-RXN == Re...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite COPROPORPHYRINOGEN_III ==
+
== Metabolite 3-oxo-D5-steroids ==
 
* common-name:
 
* common-name:
** coproporphyrinogen iii
+
** a 3-oxo-δ5-steroid
* molecular-weight:
 
** 656.734
 
* inchi-key:
 
** niuvhxtxuxofeb-uhfffaoysa-j
 
* smiles:
 
** cc1(=c2(cc5(=c(c)c(ccc([o-])=o)=c(cc4(=c(ccc([o-])=o)c(c)=c(cc3(=c(ccc(=o)[o-])c(c)=c(cc(=c(ccc([o-])=o)1)n2)n3))n4))n5)))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HEMN-RXN]]
+
* [[1.1.1.145-RXN]]
* [[RXN0-1461]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[UROGENDECARBOX-RXN]]
+
* [[1.1.1.145-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=coproporphyrinogen iii}}
+
{{#set: common-name=a 3-oxo-δ5-steroid}}
{{#set: molecular-weight=656.734}}
 
{{#set: inchi-key=inchikey=niuvhxtxuxofeb-uhfffaoysa-j}}
 

Latest revision as of 19:35, 17 March 2021

Metabolite 3-oxo-D5-steroids

  • common-name:
    • a 3-oxo-δ5-steroid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality