Difference between revisions of "ALPHA-D-GALACTOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-Introns == * common-name: ** a trna intron with a 2',3'-cyclic phosphate and a 5'-hydroxyl terminus == Reaction(s) known to consume...") |
(Created page with "Category:metabolite == Metabolite ALPHA-D-GALACTOSE == * common-name: ** α-d-galactopyranose * molecular-weight: ** 180.157 * inchi-key: ** wqzgkkkjijffok-phyprbdbsa...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ALPHA-D-GALACTOSE == |
* common-name: | * common-name: | ||
− | ** | + | ** α-d-galactopyranose |
+ | * molecular-weight: | ||
+ | ** 180.157 | ||
+ | * inchi-key: | ||
+ | ** wqzgkkkjijffok-phyprbdbsa-n | ||
+ | * smiles: | ||
+ | ** c(o)c1(oc(o)c(o)c(o)c(o)1) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[ALDOSE1EPIM-RXN]] | ||
+ | * [[GALACTOKIN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ALDOSE1EPIM-RXN]] |
+ | * [[GALACTOKIN-RXN]] | ||
+ | * [[RXN-11501]] | ||
+ | * [[RXN-12088]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=α-d-galactopyranose}} |
+ | {{#set: molecular-weight=180.157}} | ||
+ | {{#set: inchi-key=inchikey=wqzgkkkjijffok-phyprbdbsa-n}} |
Latest revision as of 19:36, 17 March 2021
Contents
Metabolite ALPHA-D-GALACTOSE
- common-name:
- α-d-galactopyranose
- molecular-weight:
- 180.157
- inchi-key:
- wqzgkkkjijffok-phyprbdbsa-n
- smiles:
- c(o)c1(oc(o)c(o)c(o)c(o)1)