Difference between revisions of "ALA-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OLEATE-CPD == * common-name: ** oleate * molecular-weight: ** 281.457 * inchi-key: ** zqppmhvwecsirj-ktkrtigzsa-m * smiles: ** ccccccccc=...")
 
(Created page with "Category:metabolite == Metabolite ALA-tRNAs == * common-name: ** a trnaala == Reaction(s) known to consume the compound == * ALANINE--TRNA-LIGASE-RXN == Reaction(s) kn...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OLEATE-CPD ==
+
== Metabolite ALA-tRNAs ==
 
* common-name:
 
* common-name:
** oleate
+
** a trnaala
* molecular-weight:
 
** 281.457
 
* inchi-key:
 
** zqppmhvwecsirj-ktkrtigzsa-m
 
* smiles:
 
** ccccccccc=ccccccccc([o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9644]]
+
* [[ALANINE--TRNA-LIGASE-RXN]]
* [[RXN0-7239]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15035]]
 
* [[RXN-15067]]
 
* [[RXN-15068]]
 
* [[RXN-9666]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=oleate}}
+
{{#set: common-name=a trnaala}}
{{#set: molecular-weight=281.457}}
 
{{#set: inchi-key=inchikey=zqppmhvwecsirj-ktkrtigzsa-m}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite ALA-tRNAs

  • common-name:
    • a trnaala

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality