Difference between revisions of "A-pyruvate-dehydrogenase-E2-protein-Nsup"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXY-CTP == * common-name: ** 5-hydroxy-ctp * molecular-weight: ** 495.126 * inchi-key: ** dmfodundoduqkk-uakxsshosa-j * smiles: **...")
(Created page with "Category:metabolite == Metabolite CPD-11409 == * common-name: ** tetraiodothyroacetate ether glucuronide * molecular-weight: ** 921.943 * inchi-key: ** gyorpzqlvmnogy-rupw...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-HYDROXY-CTP ==
+
== Metabolite CPD-11409 ==
 
* common-name:
 
* common-name:
** 5-hydroxy-ctp
+
** tetraiodothyroacetate ether glucuronide
 
* molecular-weight:
 
* molecular-weight:
** 495.126
+
** 921.943
 
* inchi-key:
 
* inchi-key:
** dmfodundoduqkk-uakxsshosa-j
+
** gyorpzqlvmnogy-rupwjetcsa-l
 
* smiles:
 
* smiles:
** c(c2(c(c(o)c(n1(c(n=c(c(o)=c1)n)=o))o2)o))op(op(op([o-])([o-])=o)([o-])=o)([o-])=o
+
** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c(i)=c3))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-7080]]
+
* [[RXN-10616]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-hydroxy-ctp}}
+
{{#set: common-name=tetraiodothyroacetate ether glucuronide}}
{{#set: molecular-weight=495.126}}
+
{{#set: molecular-weight=921.943}}
{{#set: inchi-key=inchikey=dmfodundoduqkk-uakxsshosa-j}}
+
{{#set: inchi-key=inchikey=gyorpzqlvmnogy-rupwjetcsa-l}}

Revision as of 15:05, 15 March 2021

Metabolite CPD-11409

  • common-name:
    • tetraiodothyroacetate ether glucuronide
  • molecular-weight:
    • 921.943
  • inchi-key:
    • gyorpzqlvmnogy-rupwjetcsa-l
  • smiles:
    • c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c(i)=c3))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality