Difference between revisions of "2-KETO-6-AMINO-CAPROATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6124 == * common-name: ** 1-pyrroline * molecular-weight: ** 70.114 * inchi-key: ** zvjhjddkyzxrji-uhfffaoysa-o * smiles: ** c1(cc[n+...")
(Created page with "Category:metabolite == Metabolite DIHYDROXY-ACETONE-PHOSPHATE == * common-name: ** glycerone phosphate * molecular-weight: ** 168.043 * inchi-key: ** gngacratggdkbx-uhfffa...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-6124 ==
+
== Metabolite DIHYDROXY-ACETONE-PHOSPHATE ==
 
* common-name:
 
* common-name:
−
** 1-pyrroline
+
** glycerone phosphate
 
* molecular-weight:
 
* molecular-weight:
−
** 70.114
+
** 168.043
 
* inchi-key:
 
* inchi-key:
−
** zvjhjddkyzxrji-uhfffaoysa-o
+
** gngacratggdkbx-uhfffaoysa-l
 
* smiles:
 
* smiles:
−
** c1(cc[n+]=c1)
+
** c(c(=o)co)op([o-])([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-6423]]
+
* [[1.1.1.8-RXN]]
 +
* [[F16ALDOLASE-RXN]]
 +
* [[GLYC3PDEHYDROGBIOSYN-RXN]]
 +
* [[QUINOLINATE-SYNTHA-RXN]]
 +
* [[RXN-15044]]
 +
* [[RXN0-5257]]
 +
* [[SEDOBISALDOL-RXN]]
 +
* [[TRIOSEPISOMERIZATION-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-6423]]
+
* [[F16ALDOLASE-RXN]]
 +
* [[GLYCERONE-KINASE-RXN]]
 +
* [[RXN-8631]]
 +
* [[RXN0-5260]]
 +
* [[SEDOBISALDOL-RXN]]
 +
* [[TRIOSEPISOMERIZATION-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=1-pyrroline}}
+
{{#set: common-name=glycerone phosphate}}
−
{{#set: molecular-weight=70.114}}
+
{{#set: molecular-weight=168.043}}
−
{{#set: inchi-key=inchikey=zvjhjddkyzxrji-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=gngacratggdkbx-uhfffaoysa-l}}

Revision as of 15:06, 15 March 2021

Metabolite DIHYDROXY-ACETONE-PHOSPHATE

  • common-name:
    • glycerone phosphate
  • molecular-weight:
    • 168.043
  • inchi-key:
    • gngacratggdkbx-uhfffaoysa-l
  • smiles:
    • c(c(=o)co)op([o-])([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=2-KETO-6-AMINO-CAPROATE&oldid=27663"