Difference between revisions of "Monoamines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HSCN == * common-name: ** thiocyanate * molecular-weight: ** 58.078 * inchi-key: ** zmzdmbwjuhkjps-uhfffaoysa-m * smiles: ** c(#n)[s-] ==...") |
(Created page with "Category:metabolite == Metabolite CPD-15666 == * common-name: ** 2-trans,6-cis-tridecadienoyl-coa * molecular-weight: ** 955.803 * inchi-key: ** oosdlbaxvxkfib-gtubxknvsa-...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-15666 == |
* common-name: | * common-name: | ||
− | ** | + | ** 2-trans,6-cis-tridecadienoyl-coa |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 955.803 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** oosdlbaxvxkfib-gtubxknvsa-j |
* smiles: | * smiles: | ||
− | ** c( | + | ** ccccccc=cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-14771]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2-trans,6-cis-tridecadienoyl-coa}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=955.803}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oosdlbaxvxkfib-gtubxknvsa-j}} |
Revision as of 15:08, 15 March 2021
Contents
Metabolite CPD-15666
- common-name:
- 2-trans,6-cis-tridecadienoyl-coa
- molecular-weight:
- 955.803
- inchi-key:
- oosdlbaxvxkfib-gtubxknvsa-j
- smiles:
- ccccccc=cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]