Difference between revisions of "All-holo-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15163 == * common-name: ** prop-2-ynal * molecular-weight: ** 54.048 * inchi-key: ** ijnjlgftsiahea-uhfffaoysa-n * smiles: ** c#cc=o...") |
(Created page with "Category:metabolite == Metabolite CPD-14601 == * common-name: ** mycophenolate * molecular-weight: ** 319.333 * inchi-key: ** hpnsfsbzbahari-rudmxatfsa-m * smiles: ** cc(c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-14601 == |
* common-name: | * common-name: | ||
| − | ** | + | ** mycophenolate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 319.333 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hpnsfsbzbahari-rudmxatfsa-m |
* smiles: | * smiles: | ||
| − | ** c | + | ** cc(ccc([o-])=o)=ccc1(=c(c(c)=c2(coc(=o)c(=c(o)1)2))oc) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-13607]] |
| + | * [[RXN-13608]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=mycophenolate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=319.333}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hpnsfsbzbahari-rudmxatfsa-m}} |
Revision as of 15:08, 15 March 2021
Contents
Metabolite CPD-14601
- common-name:
- mycophenolate
- molecular-weight:
- 319.333
- inchi-key:
- hpnsfsbzbahari-rudmxatfsa-m
- smiles:
- cc(ccc([o-])=o)=ccc1(=c(c(c)=c2(coc(=o)c(=c(o)1)2))oc)
