Difference between revisions of "2-DEHYDROPANTOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 7-AMINOMETHYL-7-DEAZAGUANINE == * common-name: ** preq1 * molecular-weight: ** 180.189 * inchi-key: ** meymblgokydglz-uhfffaoysa-o * smil...")
(Created page with "Category:metabolite == Metabolite CPD-471 == * common-name: ** (r)-3-amino-2-methylpropanoate * molecular-weight: ** 103.121 * inchi-key: ** qchpksfmdhpsnr-gsvougtgsa-n *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 7-AMINOMETHYL-7-DEAZAGUANINE ==
+
== Metabolite CPD-471 ==
 
* common-name:
 
* common-name:
** preq1
+
** (r)-3-amino-2-methylpropanoate
 
* molecular-weight:
 
* molecular-weight:
** 180.189
+
** 103.121
 
* inchi-key:
 
* inchi-key:
** meymblgokydglz-uhfffaoysa-o
+
** qchpksfmdhpsnr-gsvougtgsa-n
 
* smiles:
 
* smiles:
** c([n+])c2(c1(c(=o)nc(n)=nc=1nc=2))
+
** cc(c[n+])c([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-1321]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11210]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=preq1}}
+
{{#set: common-name=(r)-3-amino-2-methylpropanoate}}
{{#set: molecular-weight=180.189}}
+
{{#set: molecular-weight=103.121}}
{{#set: inchi-key=inchikey=meymblgokydglz-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=qchpksfmdhpsnr-gsvougtgsa-n}}

Revision as of 15:09, 15 March 2021

Metabolite CPD-471

  • common-name:
    • (r)-3-amino-2-methylpropanoate
  • molecular-weight:
    • 103.121
  • inchi-key:
    • qchpksfmdhpsnr-gsvougtgsa-n
  • smiles:
    • cc(c[n+])c([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality