Difference between revisions of "2-KETOGLUTARATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite XYLULOSE-5-PHOSPHATE == * common-name: ** d-xylulose 5-phosphate * molecular-weight: ** 228.095 * inchi-key: ** fnzlkvnuwiipsj-rfzpgflssa...")
(Created page with "Category:metabolite == Metabolite CPD-19010 == * common-name: ** 1,2-epoxy-2-methylpropane * molecular-weight: ** 72.107 * inchi-key: ** gelkghvafrcjna-uhfffaoysa-n * smil...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite XYLULOSE-5-PHOSPHATE ==
+
== Metabolite CPD-19010 ==
 
* common-name:
 
* common-name:
** d-xylulose 5-phosphate
+
** 1,2-epoxy-2-methylpropane
 
* molecular-weight:
 
* molecular-weight:
** 228.095
+
** 72.107
 
* inchi-key:
 
* inchi-key:
** fnzlkvnuwiipsj-rfzpgflssa-l
+
** gelkghvafrcjna-uhfffaoysa-n
 
* smiles:
 
* smiles:
** c(op([o-])(=o)[o-])c(o)c(o)c(=o)co
+
** cc1(c)(oc1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1TRANSKETO-RXN]]
+
* [[RXN-17589]]
* [[2TRANSKETO-RXN]]
 
* [[RIBULP3EPIM-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1TRANSKETO-RXN]]
 
* [[2TRANSKETO-RXN]]
 
* [[RIBULP3EPIM-RXN]]
 
* [[XYLULOKIN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-xylulose 5-phosphate}}
+
{{#set: common-name=1,2-epoxy-2-methylpropane}}
{{#set: molecular-weight=228.095}}
+
{{#set: molecular-weight=72.107}}
{{#set: inchi-key=inchikey=fnzlkvnuwiipsj-rfzpgflssa-l}}
+
{{#set: inchi-key=inchikey=gelkghvafrcjna-uhfffaoysa-n}}

Revision as of 15:13, 15 March 2021

Metabolite CPD-19010

  • common-name:
    • 1,2-epoxy-2-methylpropane
  • molecular-weight:
    • 72.107
  • inchi-key:
    • gelkghvafrcjna-uhfffaoysa-n
  • smiles:
    • cc1(c)(oc1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality