Difference between revisions of "ASN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ASN == * common-name: ** l-asparagine * molecular-weight: ** 132.119 * inchi-key: ** dcxyfedjocdnaf-reohclbhsa-n * smiles: ** c(cc(c(=o)[...")
(Created page with "Category:metabolite == Metabolite Corrinoid-Adenosyltransferases == * common-name: ** a [corrinoid adenosyltransferase] == Reaction(s) known to consume the compound == ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ASN ==
+
== Metabolite Corrinoid-Adenosyltransferases ==
 
* common-name:
 
* common-name:
** l-asparagine
+
** a [corrinoid adenosyltransferase]
* molecular-weight:
 
** 132.119
 
* inchi-key:
 
** dcxyfedjocdnaf-reohclbhsa-n
 
* smiles:
 
** c(cc(c(=o)[o-])[n+])(n)=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ASPARAGHYD-RXN]]
 
* [[ASPARAGINE--TRNA-LIGASE-RXN]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ASNSYNA-RXN]]
+
* [[R344-RXN]]
* [[ASNSYNB-RXN]]
 
* [[RXN-12460]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-asparagine}}
+
{{#set: common-name=a [corrinoid adenosyltransferase]}}
{{#set: molecular-weight=132.119}}
 
{{#set: inchi-key=inchikey=dcxyfedjocdnaf-reohclbhsa-n}}
 

Revision as of 15:13, 15 March 2021

Metabolite Corrinoid-Adenosyltransferases

  • common-name:
    • a [corrinoid adenosyltransferase]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [corrinoid adenosyltransferase" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.