Difference between revisions of "2-hydroxyacyl-glutathiones"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1G-768 == * common-name: ** 6-o-α-mycolyl-trehalose 6-phosphate * molecular-weight: ** 1540.305 * inchi-key: ** gxobndajnvberi-b...")
(Created page with "Category:metabolite == Metabolite GERANYL-PP == * common-name: ** geranyl diphosphate * molecular-weight: ** 311.188 * inchi-key: ** gvvpgtzrzfnkds-jxmrogbwsa-k * smiles:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1G-768 ==
+
== Metabolite GERANYL-PP ==
 
* common-name:
 
* common-name:
** 6-o-α-mycolyl-trehalose 6-phosphate
+
** geranyl diphosphate
 
* molecular-weight:
 
* molecular-weight:
** 1540.305
+
** 311.188
 
* inchi-key:
 
* inchi-key:
** gxobndajnvberi-bgzciimlsa-l
+
** gvvpgtzrzfnkds-jxmrogbwsa-k
 
* smiles:
 
* smiles:
** ccccccccccccccccccccccccccc(c(o)cccccccccccccccc2(cc(ccccccccccc1(cc(cccccccccccccccccc)1))2))c(=o)occ3(oc(c(c(c3o)o)o)oc4(c(c(c(c(o4)cop([o-])(=o)[o-])o)o)o))
+
** cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN1G-1435]]
+
* [[RXN-5109]]
 +
* [[RXN-5110]]
 +
* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[GPPSYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-o-α-mycolyl-trehalose 6-phosphate}}
+
{{#set: common-name=geranyl diphosphate}}
{{#set: molecular-weight=1540.305}}
+
{{#set: molecular-weight=311.188}}
{{#set: inchi-key=inchikey=gxobndajnvberi-bgzciimlsa-l}}
+
{{#set: inchi-key=inchikey=gvvpgtzrzfnkds-jxmrogbwsa-k}}

Revision as of 18:59, 17 March 2021

Metabolite GERANYL-PP

  • common-name:
    • geranyl diphosphate
  • molecular-weight:
    • 311.188
  • inchi-key:
    • gvvpgtzrzfnkds-jxmrogbwsa-k
  • smiles:
    • cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality