Difference between revisions of "2-hydroxyacyl-glutathiones"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD1G-768 == * common-name: ** 6-o-α-mycolyl-trehalose 6-phosphate * molecular-weight: ** 1540.305 * inchi-key: ** gxobndajnvberi-b...") |
(Created page with "Category:metabolite == Metabolite GERANYL-PP == * common-name: ** geranyl diphosphate * molecular-weight: ** 311.188 * inchi-key: ** gvvpgtzrzfnkds-jxmrogbwsa-k * smiles:...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite GERANYL-PP == |
* common-name: | * common-name: | ||
− | ** | + | ** geranyl diphosphate |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 311.188 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** gvvpgtzrzfnkds-jxmrogbwsa-k |
* smiles: | * smiles: | ||
− | ** | + | ** cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-5109]] |
+ | * [[RXN-5110]] | ||
+ | * [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[GPPSYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=geranyl diphosphate}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=311.188}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gvvpgtzrzfnkds-jxmrogbwsa-k}} |
Revision as of 18:59, 17 March 2021
Contents
Metabolite GERANYL-PP
- common-name:
- geranyl diphosphate
- molecular-weight:
- 311.188
- inchi-key:
- gvvpgtzrzfnkds-jxmrogbwsa-k
- smiles:
- cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c