Difference between revisions of "CPD-24185"

Revision as of 18:59, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-15364 ==
+== Metabolite CPD-6082 ==
 * common-name:
-** ricinoleoyl-coa
+** 3-aminopropanal
 * molecular-weight:
-** 1043.952
+** 74.102
 * inchi-key:
-** bhvzcckrrpyxcv-mgnvxpimsa-j
+** pcxdjqzlddhmgx-uhfffaoysa-o
 * smiles:
-** ccccccc(o)cc=ccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+** c(cc[n+])=o
 == Reaction(s) known to consume the compound ==
-* [[RXN-16151]]
+* [[RXN-6382]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-16151]]
+* [[POLYAMINE-OXIDASE-RXN]]
+* [[RXN-12089]]
+* [[RXN-6381]]
+* [[RXN-9015]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=ricinoleoyl-coa}}
+{{#set: common-name=3-aminopropanal}}
-{{#set: molecular-weight=1043.952}}
+{{#set: molecular-weight=74.102}}
-{{#set: inchi-key=inchikey=bhvzcckrrpyxcv-mgnvxpimsa-j}}
+{{#set: inchi-key=inchikey=pcxdjqzlddhmgx-uhfffaoysa-o}}