Difference between revisions of "5-OXOPROLINE"

Revision as of 19:02, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite AICAR ==
+== Metabolite DOPAMINE ==
 * common-name:
-** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide
+** dopamine
 * molecular-weight:
-** 336.197
+** 154.188
 * inchi-key:
-** notgfiuvdgnkri-uuokfmhzsa-l
+** vyfyytllbukuhu-uhfffaoysa-o
 * smiles:
-** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n2(c=nc(c(=o)n)=c(n)2))
+** c(cc1(c=c(c(=cc=1)o)o))[n+]
 == Reaction(s) known to consume the compound ==
-* [[AICARSYN-RXN]]
+* [[RXN6666-4]]
-* [[AICARTRANSFORM-RXN]]
+* [[RXN6666-9]]
 == Reaction(s) known to produce the compound ==
-* [[AICARSYN-RXN]]
+* [[RXN66-221]]
-* [[AICARTRANSFORM-RXN]]
-* [[GLUTAMIDOTRANS-RXN]]
-* [[RXN-14270]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide}}
+{{#set: common-name=dopamine}}
-{{#set: molecular-weight=336.197}}
+{{#set: molecular-weight=154.188}}
-{{#set: inchi-key=inchikey=notgfiuvdgnkri-uuokfmhzsa-l}}
+{{#set: inchi-key=inchikey=vyfyytllbukuhu-uhfffaoysa-o}}