Difference between revisions of "AMINOMETHYLDIHYDROLIPOYL-GCVH"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Initiation-tRNAmet == * common-name: ** initiator trnamet == Reaction(s) known to consume the compound == * RXN-16165 == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE == * common-name: ** 3-hydroxy-n6,n6,n6-trimethyl-l-lysine * molecular-weight: ** 205.276 * inchi-key...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Initiation-tRNAmet ==
+
== Metabolite 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE ==
 
* common-name:
 
* common-name:
** initiator trnamet
+
** 3-hydroxy-n6,n6,n6-trimethyl-l-lysine
 +
* molecular-weight:
 +
** 205.276
 +
* inchi-key:
 +
** zrjhlgyvucpznh-mqwkrirwsa-o
 +
* smiles:
 +
** c[n+](cccc(c(c([o-])=o)[n+])o)(c)c
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16165]]
+
* [[RXN-9896]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=initiator trnamet}}
+
{{#set: common-name=3-hydroxy-n6,n6,n6-trimethyl-l-lysine}}
 +
{{#set: molecular-weight=205.276}}
 +
{{#set: inchi-key=inchikey=zrjhlgyvucpznh-mqwkrirwsa-o}}

Revision as of 19:02, 17 March 2021

Metabolite 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE

  • common-name:
    • 3-hydroxy-n6,n6,n6-trimethyl-l-lysine
  • molecular-weight:
    • 205.276
  • inchi-key:
    • zrjhlgyvucpznh-mqwkrirwsa-o
  • smiles:
    • c[n+](cccc(c(c([o-])=o)[n+])o)(c)c

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality