Difference between revisions of "MALTOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-Containing-N7-Methylguanine-46 == * common-name: ** an n7-methylguanine46 in trna == Reaction(s) known to consume the compound == ==...") |
(Created page with "Category:metabolite == Metabolite 3-P-SERINE == * common-name: ** 3-phospho-l-serine * molecular-weight: ** 183.057 * inchi-key: ** bzqfbwgglxlepq-reohclbhsa-l * smiles: *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-P-SERINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-phospho-l-serine |
| + | * molecular-weight: | ||
| + | ** 183.057 | ||
| + | * inchi-key: | ||
| + | ** bzqfbwgglxlepq-reohclbhsa-l | ||
| + | * smiles: | ||
| + | ** c(op([o-])([o-])=o)c([n+])c(=o)[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[PSERTRANSAM-RXN]] | ||
| + | * [[RXN0-5114]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PSERTRANSAM-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-phospho-l-serine}} |
| + | {{#set: molecular-weight=183.057}} | ||
| + | {{#set: inchi-key=inchikey=bzqfbwgglxlepq-reohclbhsa-l}} | ||
Revision as of 19:03, 17 March 2021
Contents
Metabolite 3-P-SERINE
- common-name:
- 3-phospho-l-serine
- molecular-weight:
- 183.057
- inchi-key:
- bzqfbwgglxlepq-reohclbhsa-l
- smiles:
- c(op([o-])([o-])=o)c([n+])c(=o)[o-]
