Difference between revisions of "5-HYDROXYINDOLE ACETATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite S2O3 == * common-name: ** thiosulfate * molecular-weight: ** 113.126 * inchi-key: ** dhcdfwkwkrszhf-uhfffaoysa-m * smiles: ** o=s(=o)([o-...")
(Created page with "Category:metabolite == Metabolite 5-HYDROXYINDOLE_ACETATE == * common-name: ** 5-hydroxyindole acetate * molecular-weight: ** 190.178 * inchi-key: ** duugkqcegzlzno-uhfffa...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite S2O3 ==
+
== Metabolite 5-HYDROXYINDOLE_ACETATE ==
 
* common-name:
 
* common-name:
** thiosulfate
+
** 5-hydroxyindole acetate
 
* molecular-weight:
 
* molecular-weight:
** 113.126
+
** 190.178
 
* inchi-key:
 
* inchi-key:
** dhcdfwkwkrszhf-uhfffaoysa-m
+
** duugkqcegzlzno-uhfffaoysa-m
 
* smiles:
 
* smiles:
** o=s(=o)([o-])s
+
** c([o-])(=o)cc1(=cnc2(c1=cc(o)=cc=2))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[SULFOCYS-RXN]]
 
* [[THIOSULFATE-SULFURTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[SULFOCYS-RXN]]
+
* [[RXN-10780]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=thiosulfate}}
+
{{#set: common-name=5-hydroxyindole acetate}}
{{#set: molecular-weight=113.126}}
+
{{#set: molecular-weight=190.178}}
{{#set: inchi-key=inchikey=dhcdfwkwkrszhf-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=duugkqcegzlzno-uhfffaoysa-m}}

Latest revision as of 19:34, 17 March 2021

Metabolite 5-HYDROXYINDOLE_ACETATE

  • common-name:
    • 5-hydroxyindole acetate
  • molecular-weight:
    • 190.178
  • inchi-key:
    • duugkqcegzlzno-uhfffaoysa-m
  • smiles:
    • c([o-])(=o)cc1(=cnc2(c1=cc(o)=cc=2))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality