Difference between revisions of "5-HYDROXYINDOLE ACETATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite S2O3 == * common-name: ** thiosulfate * molecular-weight: ** 113.126 * inchi-key: ** dhcdfwkwkrszhf-uhfffaoysa-m * smiles: ** o=s(=o)([o-...") |
(Created page with "Category:metabolite == Metabolite 5-HYDROXYINDOLE_ACETATE == * common-name: ** 5-hydroxyindole acetate * molecular-weight: ** 190.178 * inchi-key: ** duugkqcegzlzno-uhfffa...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 5-HYDROXYINDOLE_ACETATE == |
* common-name: | * common-name: | ||
− | ** | + | ** 5-hydroxyindole acetate |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 190.178 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** duugkqcegzlzno-uhfffaoysa-m |
* smiles: | * smiles: | ||
− | ** o | + | ** c([o-])(=o)cc1(=cnc2(c1=cc(o)=cc=2)) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-10780]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=5-hydroxyindole acetate}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=190.178}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=duugkqcegzlzno-uhfffaoysa-m}} |
Latest revision as of 19:34, 17 March 2021
Contents
Metabolite 5-HYDROXYINDOLE_ACETATE
- common-name:
- 5-hydroxyindole acetate
- molecular-weight:
- 190.178
- inchi-key:
- duugkqcegzlzno-uhfffaoysa-m
- smiles:
- c([o-])(=o)cc1(=cnc2(c1=cc(o)=cc=2))