Difference between revisions of "5-PHOSPHO-RIBOSYL-GLYCINEAMIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite VibB == * common-name: ** an apo-[vibb aryl-carrier protein] == Reaction(s) known to consume the compound == * RXN-10994 == Reaction(...") |
(Created page with "Category:metabolite == Metabolite 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE == * common-name: ** n1-(5-phospho-β-d-ribosyl)glycinamide * molecular-weight: ** 285.17 * inchi-key:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE == |
* common-name: | * common-name: | ||
| − | ** | + | ** n1-(5-phospho-β-d-ribosyl)glycinamide |
| + | * molecular-weight: | ||
| + | ** 285.17 | ||
| + | * inchi-key: | ||
| + | ** obqmlsfouzuiob-shuuezrqsa-m | ||
| + | * smiles: | ||
| + | ** c([n+])c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[GART-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[GART-RXN]] |
| + | * [[GLYRIBONUCSYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n1-(5-phospho-β-d-ribosyl)glycinamide}} |
| + | {{#set: molecular-weight=285.17}} | ||
| + | {{#set: inchi-key=inchikey=obqmlsfouzuiob-shuuezrqsa-m}} | ||
Latest revision as of 19:36, 17 March 2021
Contents
Metabolite 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE
- common-name:
- n1-(5-phospho-β-d-ribosyl)glycinamide
- molecular-weight:
- 285.17
- inchi-key:
- obqmlsfouzuiob-shuuezrqsa-m
- smiles:
- c([n+])c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
