Difference between revisions of "ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DTDP-D-GLUCOSE == * common-name: ** dtdp-α-d-glucose * molecular-weight: ** 562.317 * inchi-key: ** ysykrgrsmltjnl-urarbognsa-l * s...")
(Created page with "Category:metabolite == Metabolite ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE == * common-name: ** all-trans-heptaprenyl diphosphate * molecular-weight: ** 651.779 * inchi-key: ** l...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DTDP-D-GLUCOSE ==
+
== Metabolite ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE ==
 
* common-name:
 
* common-name:
** dtdp-α-d-glucose
+
** all-trans-heptaprenyl diphosphate
 
* molecular-weight:
 
* molecular-weight:
** 562.317
+
** 651.779
 
* inchi-key:
 
* inchi-key:
** ysykrgrsmltjnl-urarbognsa-l
+
** lsjlexwxrktzaj-yuiipxgzsa-k
 
* smiles:
 
* smiles:
** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(co)c(o)c(o)c(o)2))o3))
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DTDPGLUCDEHYDRAT-RXN]]
+
* [[RXN-9222]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dtdp-α-d-glucose}}
+
{{#set: common-name=all-trans-heptaprenyl diphosphate}}
{{#set: molecular-weight=562.317}}
+
{{#set: molecular-weight=651.779}}
{{#set: inchi-key=inchikey=ysykrgrsmltjnl-urarbognsa-l}}
+
{{#set: inchi-key=inchikey=lsjlexwxrktzaj-yuiipxgzsa-k}}

Latest revision as of 19:36, 17 March 2021

Metabolite ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE

  • common-name:
    • all-trans-heptaprenyl diphosphate
  • molecular-weight:
    • 651.779
  • inchi-key:
    • lsjlexwxrktzaj-yuiipxgzsa-k
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality