Difference between revisions of "MRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE == * common-name: ** 5-amino-1-(5-phospho-β-d-ribosyl)imidazole * molecular-weight: ** 294.18 * in...")
 
(Created page with "Category:metabolite == Metabolite CPD-1301 == * common-name: ** tetrahydropteroyl tri-l-glutamate * molecular-weight: ** 699.633 * inchi-key: ** rxwvhryztwzath-xslagttesa-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE ==
+
== Metabolite CPD-1301 ==
 
* common-name:
 
* common-name:
** 5-amino-1-(5-phospho-β-d-ribosyl)imidazole
+
** tetrahydropteroyl tri-l-glutamate
 
* molecular-weight:
 
* molecular-weight:
** 294.18
+
** 699.633
 
* inchi-key:
 
* inchi-key:
** pdacukokvhbvhj-xvfcmesisa-m
+
** rxwvhryztwzath-xslagttesa-j
 
* smiles:
 
* smiles:
** c2([n+]=cn(c1(oc(cop([o-])(=o)[o-])c(o)c(o)1))c(n)=2)
+
** c([ch]2(nc1(c(nc(=nc=1nc2)n)=o)))nc3(=cc=c(c(nc(c(=o)[o-])ccc(nc(c(=o)[o-])ccc(nc(c(=o)[o-])ccc([o-])=o)=o)=o)=o)c=c3)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AIRCARBOXY-RXN]]
+
* [[HOMOCYSMET-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[AIRCARBOXY-RXN]]
+
* [[HOMOCYSMET-RXN]]
* [[AIRS-RXN]]
+
* [[RXN-12730]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-amino-1-(5-phospho-β-d-ribosyl)imidazole}}
+
{{#set: common-name=tetrahydropteroyl tri-l-glutamate}}
{{#set: molecular-weight=294.18}}
+
{{#set: molecular-weight=699.633}}
{{#set: inchi-key=inchikey=pdacukokvhbvhj-xvfcmesisa-m}}
+
{{#set: inchi-key=inchikey=rxwvhryztwzath-xslagttesa-j}}

Revision as of 17:51, 13 January 2021

Metabolite CPD-1301

  • common-name:
    • tetrahydropteroyl tri-l-glutamate
  • molecular-weight:
    • 699.633
  • inchi-key:
    • rxwvhryztwzath-xslagttesa-j
  • smiles:
    • c([ch]2(nc1(c(nc(=nc=1nc2)n)=o)))nc3(=cc=c(c(nc(c(=o)[o-])ccc(nc(c(=o)[o-])ccc(nc(c(=o)[o-])ccc([o-])=o)=o)=o)=o)c=c3)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality