Difference between revisions of "MANNOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-130 == * common-name: ** zeaxanthin * molecular-weight: ** 568.881 * inchi-key: ** jkqxzkusfckogq-qaybqhtqsa-n * smiles: ** cc(c=cc...")
 
(Created page with "Category:metabolite == Metabolite CHLOROPHYLL-B == * common-name: ** chlorophyll b * molecular-weight: ** 907.486 * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1F-130 ==
+
== Metabolite CHLOROPHYLL-B ==
 
* common-name:
 
* common-name:
** zeaxanthin
+
** chlorophyll b
 
* molecular-weight:
 
* molecular-weight:
** 568.881
+
** 907.486
* inchi-key:
 
** jkqxzkusfckogq-qaybqhtqsa-n
 
 
* smiles:
 
* smiles:
** cc(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)=cc=cc=c(c=cc=c(c=cc2(=c(cc(cc(c)(c)2)o)c))c)c
+
** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c5(=n(.[mg]36(.n1(=c(c(cc)=c(c=o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)c(c(oc)=o)c5=c(n67)8)))))9))))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13185]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13185]]
+
* [[RXN-7674]]
* [[RXN-7985]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=zeaxanthin}}
+
{{#set: common-name=chlorophyll b}}
{{#set: molecular-weight=568.881}}
+
{{#set: molecular-weight=907.486}}
{{#set: inchi-key=inchikey=jkqxzkusfckogq-qaybqhtqsa-n}}
 

Revision as of 17:52, 13 January 2021

Metabolite CHLOROPHYLL-B

  • common-name:
    • chlorophyll b
  • molecular-weight:
    • 907.486
  • smiles:
    • c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c5(=n(.[mg]36(.n1(=c(c(cc)=c(c=o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)c(c(oc)=o)c5=c(n67)8)))))9))))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality