Difference between revisions of "3-SULFINOALANINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DMPBQ == * common-name: ** 2,3-dimethyl-6-phytyl-1,4-benzoquinol * molecular-weight: ** 416.686 * inchi-key: ** sufzkubnovdjrr-wgeodtkdsa...")
 
(Created page with "Category:metabolite == Metabolite 3-oxo-D5-steroids == * common-name: ** a 3-oxo-δ5-steroid == Reaction(s) known to consume the compound == * 1.1.1.145-RXN == Re...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DMPBQ ==
+
== Metabolite 3-oxo-D5-steroids ==
 
* common-name:
 
* common-name:
** 2,3-dimethyl-6-phytyl-1,4-benzoquinol
+
** a 3-oxo-δ5-steroid
* molecular-weight:
 
** 416.686
 
* inchi-key:
 
** sufzkubnovdjrr-wgeodtkdsa-n
 
* smiles:
 
** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c(c)=c(c)c(o)=1))c)c
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2543]]
+
* [[1.1.1.145-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2542]]
+
* [[1.1.1.145-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2,3-dimethyl-6-phytyl-1,4-benzoquinol}}
+
{{#set: common-name=a 3-oxo-δ5-steroid}}
{{#set: molecular-weight=416.686}}
 
{{#set: inchi-key=inchikey=sufzkubnovdjrr-wgeodtkdsa-n}}
 

Revision as of 17:55, 13 January 2021

Metabolite 3-oxo-D5-steroids

  • common-name:
    • a 3-oxo-δ5-steroid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality