Difference between revisions of "2-METHYL-ACETO-ACETYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15678 == * common-name: ** 4-trans-3-oxo-undecenoyl-coa * molecular-weight: ** 943.749 * inchi-key: ** xbfqfvlnmjddng-dupkwvsksa-j *...")
 
(Created page with "Category:metabolite == Metabolite Octadec-2-enoyl-ACPs == * common-name: ** a (2e)-octadec-2-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9635 * [...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15678 ==
+
== Metabolite Octadec-2-enoyl-ACPs ==
 
* common-name:
 
* common-name:
** 4-trans-3-oxo-undecenoyl-coa
+
** a (2e)-octadec-2-enoyl-[acp]
* molecular-weight:
 
** 943.749
 
* inchi-key:
 
** xbfqfvlnmjddng-dupkwvsksa-j
 
* smiles:
 
** ccccccc=cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14793]]
+
* [[RXN-9635]]
 +
* [[RXN3O-5293]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9634]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-trans-3-oxo-undecenoyl-coa}}
+
{{#set: common-name=a (2e)-octadec-2-enoyl-[acp]}}
{{#set: molecular-weight=943.749}}
 
{{#set: inchi-key=inchikey=xbfqfvlnmjddng-dupkwvsksa-j}}
 

Revision as of 17:55, 13 January 2021

Metabolite Octadec-2-enoyl-ACPs

  • common-name:
    • a (2e)-octadec-2-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (2e)-octadec-2-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.