Difference between revisions of "ALA-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite OLEATE-CPD == * common-name: ** oleate * molecular-weight: ** 281.457 * inchi-key: ** zqppmhvwecsirj-ktkrtigzsa-m * smiles: ** ccccccccc=...") |
(Created page with "Category:metabolite == Metabolite PHENYLACETATE == * common-name: ** phenylacetate * molecular-weight: ** 135.142 * inchi-key: ** wljvxdmoqogphl-uhfffaoysa-m * smiles: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PHENYLACETATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** phenylacetate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 135.142 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wljvxdmoqogphl-uhfffaoysa-m |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(=cc=c(c=c1)cc([o-])=o) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[PHENDEHYD-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PHENDEHYD-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=phenylacetate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=135.142}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wljvxdmoqogphl-uhfffaoysa-m}} |
Revision as of 17:56, 13 January 2021
Contents
Metabolite PHENYLACETATE
- common-name:
- phenylacetate
- molecular-weight:
- 135.142
- inchi-key:
- wljvxdmoqogphl-uhfffaoysa-m
- smiles:
- c1(=cc=c(c=c1)cc([o-])=o)
