Difference between revisions of "3-Methyl-Saturated-Fatty-Acyl-CoA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15180 == * common-name: ** a 1-acyl-sn-glycero-3-phospho-d-myo-inositol == Reaction(s) known to consume the compound == == Reaction(s...") |
(Created page with "Category:metabolite == Metabolite CPD-11408 == * common-name: ** triiodothyronine sulfate * molecular-weight: ** 730.028 * inchi-key: ** xbqyqxvjbndcgy-lbprgkrzsa-m * smil...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-11408 == |
* common-name: | * common-name: | ||
| − | ** | + | ** triiodothyronine sulfate |
| + | * molecular-weight: | ||
| + | ** 730.028 | ||
| + | * inchi-key: | ||
| + | ** xbqyqxvjbndcgy-lbprgkrzsa-m | ||
| + | * smiles: | ||
| + | ** c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))=2)i) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-10615]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=triiodothyronine sulfate}} |
| + | {{#set: molecular-weight=730.028}} | ||
| + | {{#set: inchi-key=inchikey=xbqyqxvjbndcgy-lbprgkrzsa-m}} | ||
Revision as of 17:57, 13 January 2021
Contents
Metabolite CPD-11408
- common-name:
- triiodothyronine sulfate
- molecular-weight:
- 730.028
- inchi-key:
- xbqyqxvjbndcgy-lbprgkrzsa-m
- smiles:
- c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))=2)i)
