Difference between revisions of "3-oxo-lignoceroyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15318 == * common_name: ** α-d-ribose 5-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1) * inchi_key: ** inchikey=k...")
 
(Created page with "Category:metabolite == Metabolite CPD-18494 == * common-name: ** (6z,9z,12z,15z,18z)-3-oxotetracosapentaenoyl-coa * molecular-weight: ** 1118.034 * inchi-key: ** uiagujimv...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15318 ==
+
== Metabolite CPD-18494 ==
* common_name:
+
* common-name:
** α-d-ribose 5-phosphate
+
** (6z,9z,12z,15z,18z)-3-oxotetracosapentaenoyl-coa
 +
* molecular-weight:
 +
** 1118.034
 +
* inchi-key:
 +
** uiagujimvqpsdp-qojzhlsosa-j
 
* smiles:
 
* smiles:
** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1)
+
** cccccc=ccc=ccc=ccc=ccc=cccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
* inchi_key:
 
** inchikey=ktvpxoyakdprhy-aihaylrmsa-l
 
* molecular_weight:
 
** 228.095   
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14997]]
+
* [[RXN-17116]]
* [[RXN-15345]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17115]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common_name=α-d-ribose 5-phosphate}}
+
{{#set: common-name=(6z,9z,12z,15z,18z)-3-oxotetracosapentaenoyl-coa}}
{{#set: inchi_key=inchikey=ktvpxoyakdprhy-aihaylrmsa-l}}
+
{{#set: molecular-weight=1118.034}}
{{#set: molecular_weight=228.095    }}
+
{{#set: inchi-key=inchikey=uiagujimvqpsdp-qojzhlsosa-j}}

Revision as of 17:50, 13 January 2021

Metabolite CPD-18494

  • common-name:
    • (6z,9z,12z,15z,18z)-3-oxotetracosapentaenoyl-coa
  • molecular-weight:
    • 1118.034
  • inchi-key:
    • uiagujimvqpsdp-qojzhlsosa-j
  • smiles:
    • cccccc=ccc=ccc=ccc=ccc=cccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality