Difference between revisions of "B-ALANINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-520 == * common-name: ** quercetin * molecular-weight: ** 301.232 * inchi-key: ** refjwtpedvjjiy-uhfffaoysa-m * smiles: ** c1(c=c(o)c...") |
(Created page with "Category:metabolite == Metabolite D-RIBULOSE-15-P2 == * common-name: ** d-ribulose-1,5-bisphosphate * molecular-weight: ** 306.059 * inchi-key: ** yahzabjorduqgo-nqxxgfsbs...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite D-RIBULOSE-15-P2 == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-ribulose-1,5-bisphosphate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 306.059 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yahzabjorduqgo-nqxxgfsbsa-j |
* smiles: | * smiles: | ||
| − | ** | + | ** c(op([o-])([o-])=o)c(o)c(o)c(=o)cop(=o)([o-])[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[PHOSPHORIBULOKINASE-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[PHOSPHORIBULOKINASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-ribulose-1,5-bisphosphate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=306.059}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yahzabjorduqgo-nqxxgfsbsa-j}} |
Revision as of 17:50, 13 January 2021
Contents
Metabolite D-RIBULOSE-15-P2
- common-name:
- d-ribulose-1,5-bisphosphate
- molecular-weight:
- 306.059
- inchi-key:
- yahzabjorduqgo-nqxxgfsbsa-j
- smiles:
- c(op([o-])([o-])=o)c(o)c(o)c(=o)cop(=o)([o-])[o-]
