Difference between revisions of "2E-7Z-hexadeca-2-7-dienoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-139 == * common-name: ** gibberellin a1 * molecular-weight: ** 347.387 * inchi-key: ** jljlrlwoemwyqk-sntjwbgvsa-m * smiles: ** c=c...")
 
(Created page with "Category:metabolite == Metabolite CPD-11409 == * common-name: ** tetraiodothyroacetate ether glucuronide * molecular-weight: ** 921.943 * inchi-key: ** gyorpzqlvmnogy-rupw...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1F-139 ==
+
== Metabolite CPD-11409 ==
 
* common-name:
 
* common-name:
** gibberellin a1
+
** tetraiodothyroacetate ether glucuronide
 
* molecular-weight:
 
* molecular-weight:
** 347.387
+
** 921.943
 
* inchi-key:
 
* inchi-key:
** jljlrlwoemwyqk-sntjwbgvsa-m
+
** gyorpzqlvmnogy-rupwjetcsa-l
 
* smiles:
 
* smiles:
** c=c1(c3(o)(cc4(c1)(c([ch]5(c2(c(=o)oc(ccc(o)2)([ch](cc3)4)5)(c)))c([o-])=o)))
+
** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c(i)=c3))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-115]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10616]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=gibberellin a1}}
+
{{#set: common-name=tetraiodothyroacetate ether glucuronide}}
{{#set: molecular-weight=347.387}}
+
{{#set: molecular-weight=921.943}}
{{#set: inchi-key=inchikey=jljlrlwoemwyqk-sntjwbgvsa-m}}
+
{{#set: inchi-key=inchikey=gyorpzqlvmnogy-rupwjetcsa-l}}

Revision as of 17:50, 13 January 2021

Metabolite CPD-11409

  • common-name:
    • tetraiodothyroacetate ether glucuronide
  • molecular-weight:
    • 921.943
  • inchi-key:
    • gyorpzqlvmnogy-rupwjetcsa-l
  • smiles:
    • c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c(i)=c3))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality