Difference between revisions of "DOLICHOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite XANTHINE == * common-name: ** xanthine * molecular-weight: ** 152.112 * inchi-key: ** lrfvtywoqmyalw-uhfffaoysa-n * smiles: ** c12(nc(=o)...")
 
(Created page with "Category:metabolite == Metabolite CPD-17283 == * common-name: ** a [glycerolipid]-di-homo-γ-linolenate == Reaction(s) known to consume the compound == == Reaction(s)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite XANTHINE ==
+
== Metabolite CPD-17283 ==
 
* common-name:
 
* common-name:
** xanthine
+
** a [glycerolipid]-di-homo-γ-linolenate
* molecular-weight:
 
** 152.112
 
* inchi-key:
 
** lrfvtywoqmyalw-uhfffaoysa-n
 
* smiles:
 
** c12(nc(=o)nc(c=1n=cn2)=o)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-901]]
 
* [[XANTHINE-OXIDASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GUANINE-DEAMINASE-RXN]]
+
* [[RXN-16044]]
* [[RXN-7682]]
 
* [[RXN0-901]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=xanthine}}
+
{{#set: common-name=a [glycerolipid]-di-homo-γ-linolenate}}
{{#set: molecular-weight=152.112}}
 
{{#set: inchi-key=inchikey=lrfvtywoqmyalw-uhfffaoysa-n}}
 

Revision as of 17:51, 13 January 2021

Metabolite CPD-17283

  • common-name:
    • a [glycerolipid]-di-homo-γ-linolenate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycerolipid]-di-homo-γ-linolenate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.